What is the structure of Phthalaldehyde?
Phthalaldehyde (sometimes also o-phthalaldehyde or ortho-phthalaldehyde, OPA) is the chemical compound with the formula C6H4(CHO)2. It is one of three isomers of benzene dicarbaldehyde, related to phthalic acid.
What is the unique characteristic of an ortho Phthalaldehyde?
It has excellent stability over a wide pH range (pH 3 to 9), is not a known irritant to the eyes and nasal passages, does not require exposure monitoring, has a barely perceptible odor, and requires no activation.
How many aldehyde groups does the compound phthalaldehyde have?
two formyl groups
Phthalaldehyde is a dialdehyde in which two formyl groups are attached to adjacent carbon centres on a benzene ring.
What is O-Phthalaldehyde used for?
It is used for the detection of many biogenic amines, peptides, and proteins in nanogram quantities in body fluids. O-Phthalaldehyde is approved by FDA for use in test systems to detect blood urea nitrogen (BUN) for the diagnosis and treatment of certain renal and metabolic diseases.
What is Iupac name of Phthalaldehyde?
| IUPAC Name | phthalaldehyde |
|---|---|
| Alternative Names | Benzene-1,2-dicarboxaldehyde 1,2-Benzenedicarboxaldehyde Phthalic aldehyde |
| Molecular Formula | C8H6O2 |
| Molar Mass | 134.134 g/mol |
| InChI | InChI=1S/C8H6O2/c9-5-7-3-1-2-4-8(7)6-10/h1-6H |
What is the Iupac name of Phthalaldehyde?
What is substitute a mine called?
Solution. The substituted imine is called a Schiff’s base.
What are aromatic ketones?
Aromatic ketones are important organic intermedi- ates in the industries of flavors, perfumes, pharmaceuticals, and agrochemicals. Traditionally, these ketones were pro- duced by Friedel-Crafts acylation of aromatic compounds using Lewis acids or strong protonic acids as catalysts.
Is glutaraldehyde soluble in water?
Glutaraldehyde is a dialdehyde….Glutaraldehyde.
| Names | |
|---|---|
| Melting point | −14 °C (7 °F; 259 K) |
| Boiling point | 187 °C (369 °F; 460 K) |
| Solubility in water | Miscible, reacts |
| Vapor pressure | 17 mmHg (20°C) |
What is phenolic water?
Phenolic compounds exist in water bodies due to the discharge of polluted wastewater from industrial, agricultural and domestic activities into water bodies. They also occur as a result of natural phenomena.
What is the chemical name of phthalaldehyde?
Phthalaldehyde (sometimes also o-phthalaldehyde or ortho-phthalaldehyde, OPA) is the chemical compound with the formula C 6 H 4 (CHO) 2. It is one of three isomers of benzene dicarbaldehyde, related to phthalic acid. This pale yellow solid is a building block in the synthesis of heterocyclic compounds and a reagent in the analysis of amino acids.
What is Phthalaldehyde OPA?
Phthalaldehyde. This pale yellow solid is a building block in the synthesis of heterocyclic compounds and a reagent in the analysis of amino acids. OPA dissolves in water solution at pH < 11.5. Its solutions degrade upon UV illumination and exposure to air.
Is isophthalaldehyde a solid liquid or gas?
IDENTIFICATION: Isophthalaldehyde is a solid. It is soluble in water. USE: m-Phthalaldehyde is used as a laboratory chemical. EXPOSURE: Workers that produce or use isophthalaldehyde may have direct skin contact. The general population is not likely to be exposed to isophthalaldehyde.
What is the half life of isophthalaldehyde in the atmosphere?
Vapor-phase isophthalaldehyde will be degraded in the atmosphere by reaction with photochemically-produced hydroxyl radicals; the half-life for this reaction in air is estimated to be 11 hours.